Flocoumafen
IUPAC name	2-hydroxy- 3-[3-[4- ([4-(trifluoromethyl) phenyl] methoxy) phenyl]- 1,2,3,4- tetrahydronaphthalen- 1-yl] chromen- 4-one
Identifiers
CAS number	90035-08-8
PubChem	91748
SMILES	C1C(CC2=CC=CC=C2C1C3=C(OC4=CC=CC=C4C3=O)O)C5=CC=C(C=C5)OCC6=CC=C(C=C6)C(F)(F)F
Properties
Molecular formula	C33H25F3O4
Molar mass	542.54441
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)
Infobox references

Flocoumafen is a secound generation anticoagulant used as a rodenticide. It has a very high toxicity and is restricted to indoor use and sewers (in the UK). This restriction is mainly due to the increased risk to non-target species. Studies have shown that rodents resistant to first generation anticoagulants, can be adequately controlled with Flocoumafen.

This chemistry article is a stub. You can help Wikipedia by expanding it. v • d • e