Deoxyuridine
Identifiers
CAS number	951-78-0 Y
PubChem	640
MeSH	Deoxyuridine
SMILES	C1C(C(OC1N2C=CC(=O)NC2=O)CO)O
Properties
Molecular formula	C9H12N2O5
Molar mass	228.202
Y (what is this?)  (verify) Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)
Infobox references

Deoxyuridine is a compound and a nucleoside. It is similar in chemical structure to uridine, but without the 2'-hydroxyl group.

Idoxuridine and Trifluridine are variants of deoxyuridine used as antiviral drugs. They are similar enough to be incorporated as part of DNA replication, but they possess side groups on the uracil component (an iodine and a CF₃ group, respectively), that prevent base pairing.

This biochemistry article is a stub. You can help Wikipedia by expanding it. v • d • e