DMDNB
IUPAC name	2,3-Dimethyl-2,3-dinitrobutane
Other names	2,3-Dimethyl-2,3-dinitro-n-butane, DMDNB, DMNB
Identifiers
CAS number	3964-18-9
PubChem	77577
SMILES	CC(C)(N(=O)=O)C(C)(C)N(=O)=O
InChI	1/C6H12N2O4/c1-5(2,7(9)10)6(3,4)8(11)12/h1-4H3
Properties
Molecular formula	C6H12N2O4
Molar mass	176.17 g/mol
Melting point	210 - 214 °C
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)
Infobox references

DMDNB, or also DMNB, chemically 2,3-dimethyl-2,3-dinitrobutane, is a volatile organic compound used as a detection taggant for explosives, mostly in the United States where it is virtually the only such taggant in use. Dogs are very sensitive to it and can detect as little as 0.5 parts per billion in the air, as can specialised ion mobility spectrometers. Its presence allows more reliable explosive detection.

Its formula is CH₃-C(CH₃)(NO₂)-C(CH₃)(NO₂)-CH₃.