| Bixin[1] |  | | IUPAC name | (2E,4E,6E,8E,10E,12E,14E,16Z,18E)-20-methoxy-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid | | Other names | cis-Bixin; α-Bixin; 9-cis-6,6'-Diapo-ψ,ψ-carotenedioic acid, 6-methyl ester | | Identifiers | | CAS number | 6983-79-5, 39937-23-0 (trans-Bixin) | | PubChem | 5281226 | | SMILES | O=C(O)\C=C\C(=C\C=C\C(=C\C=C\C=C(\C=C\C=C(/C=C/C(=O)OC)C)C)C)C | | InChI | 1/C25H30O4/c1-20(12-8-14-22(3)16-18-24(26)27)10-6-7-11-21(2)13-9-15-23(4)17-19-25(28)29-5/h6-19H,1-5H3,(H,26,27)/b7-6+,12-8+,13-9+,18-16+,19-17+,20-10+,21-11+,22-14+,23-15- | | InChI key | RAFGELQLHMBRHD-SLEZCNMEBU | | ChemSpider ID | 4444638 | | Properties | | Molecular formula | C25H30O4 | | Molar mass | 394.5 g mol−1 | | Appearance | Orange crystals | | Solubility in water | Insoluble | | Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | | Infobox references | Bixin is an apocarotenoid found in annatto, a natural food coloring obtained from the seeds of the achiote tree (Bixa orellana). Annatto seeds contain about 5% pigments, which consist of 70-80% bixin.[2] Bixin is chemically unstable when isolated and converts via isomerization into trans-bixin (β-bixin), the double-bond isomer.[1] Bixin is soluble in fats but insoluble in water. Upon exposure to alkali, the methyl ester is hydrolyzed to produce the dicarboxylic acid norbixin, a water-soluble derivative. -
Chemical structure of trans-bixin -
[edit] References |