| Andrographolide |
 |
| IUPAC name | 3-[2-[decahydro-6-hydroxy-5- (hydroxymethyl)-5,8a- dimethyl-2-methylene-1- napthalenyl]ethylidene]dihydro- 4-hydroxy-2(3H)-furanone |
| Identifiers |
| CAS number | 5508-58-7 Y |
| PubChem | 5318517 |
| SMILES | O=C3OCC(O)C3=CCC1\C(=C)CCC2C(C)(CO)C(O)CCC12C |
| InChI | 1/C20H30O5/c1-12-4-7-16-19(2,9-8-17(23)20(16,3)11-21)14(12)6-5-13-15(22)10-25-18(13)24/h5,14-17,21-23H,1,4,6-11H2,2-3H3 |
| InChI key | BOJKULTULYSRAS-UHFFFAOYAB |
| ChemSpider ID | 304590 |
| Properties |
| Molecular formula | C20H30O5 |
| Molar mass | 350.45 g/mol |
| Exact mass | 350.209324 |
| Appearance | Rhombic prisms or plates from ethanol or methanol |
| Density | 1.2317 g/cm3 |
| Melting point | 230-231 °C |
| Solubility in water | Sparingly soluble |
| Related compounds |
| Related labdanes | 14-deoxyandrographolide |
Y (what is this?) (verify) Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
| Infobox references |
Andrographolide is a labdane diterpenoid that is the main bioactive component of the medicinal plant Andrographis paniculata.[1] Andrographolide is an extremely bitter substance extracted from the stem and leaves of the andrographis paniculata, which is grown for medicinal purposes in China and India. Andrographolide has been shown to be effective against certain cancers and is an effective purgative.
[edit] References
- ^ Chakravarti RN, Chakravarti D (1951). "Andrographolide, the active constituent of Andrographis paniculata Nees; a preliminary communication". Ind Med Gaz 86 (3): 96–7. PMID 14860885.